| MolName | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide |
| MolecularFormula | C25H17N3O3Cl2S |
| Smiles | O=C(c1ccc(CN(c2cccc3cccc4c23)S4(=O)=O)cc1)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C25H17Cl2N3O3S/c26-20-12-9-17(13-21(20)27)14-28-29-25(31)19-10-7-16(8-11-19)15-30-22-5-1-3-18-4-2-6-23(24(18)22)34(30,32)33/h1-14H,15H2,(H,29,31) |
| InChIK | GADWFMZJVQHADG-UHFFFAOYSA-N |
| TotalMolweight | 510.4 |
| Molweight | 510.4 |
| MonoisotopicMass | 509.036766 |
| CLogP | 6.0086 |
| CLogS | -8.479 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 351.33 |
| Relative PSA | 0.19395 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | 1.1376 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide | 2 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide