| MolName | [2,4-dibromo-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C22H12N2O4Br5I |
| Smiles | O=C(COc(c(Br)cc(Br)c1)c1Br)N/N=C\c1cc(Br)cc(Br)c1OC(c(cccc1)c1I)=O |
| InChI | InChI=1S/C22H12Br5IN2O4/c23-12-5-11(20(15(25)6-12)34-22(32)14-3-1-2-4-18(14)28)9-29-30-19(31)10-33-21-16(26)7-13(24)8-17(21)27/h1-9H,10H2,(H,30,31) |
| InChIK | GAVRWTZRUUUWFZ-UHFFFAOYSA-N |
| TotalMolweight | 894.767 |
| Molweight | 894.767 |
| MonoisotopicMass | 889.575861 |
| CLogP | 8.2701 |
| CLogS | -10.157 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 417.69 |
| Relative PSA | 0.16531 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.6318 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate