| MolName | [4-[(Z)-[(2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C28H21N2O3Cl |
| Smiles | O=C(C(c1ccccc1)c1ccccc1)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C28H21ClN2O3/c29-25-14-8-7-13-24(25)28(33)34-23-17-15-20(16-18-23)19-30-31-27(32)26(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-19,26H,(H,31,32) |
| InChIK | GAXYFTUSLMBBIQ-UHFFFAOYSA-N |
| TotalMolweight | 468.939 |
| Molweight | 468.939 |
| MonoisotopicMass | 468.12407 |
| CLogP | 6.7638 |
| CLogS | -7.041 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 362.18 |
| Relative PSA | 0.16304 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 4.7761 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-[(Z)-[(2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate