| MolName | 3-(2-chlorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C19H20N5OClS |
| Smiles | CCN(CC)c1cc(O)c(C=NN(C(c(cccc2)c2Cl)=NN2)C2=S)cc1 |
| InChI | InChI=1S/C19H20ClN5OS/c1-3-24(4-2)14-10-9-13(17(26)11-14)12-21-25-18(22-23-19(25)27)15-7-5-6-8-16(15)20/h5-12,26H,3-4H2,1-2H3,(H,23,27) |
| InChIK | GBCQXDYDTICGJH-UHFFFAOYSA-N |
| TotalMolweight | 401.921 |
| Molweight | 401.921 |
| MonoisotopicMass | 401.107707 |
| CLogP | 4.2643 |
| CLogS | -5.527 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 305.83 |
| Relative PSA | 0.27035 |
| PolarSurfaceArea | 95.55 |
| Druglikeness | 4.937 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2-chlorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2-chlorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione