| MolName | N-[(2Z,4E)-1-[(2Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| MolecularFormula | C29H22N3O3Br |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C/C=C/c1ccccc1)N/N=C\c1ccc(-c(cc2)ccc2Br)o1 |
| InChI | InChI=1S/C29H22BrN3O3/c30-24-16-14-22(15-17-24)27-19-18-25(36-27)20-31-33-29(35)26(13-7-10-21-8-3-1-4-9-21)32-28(34)23-11-5-2-6-12-23/h1-20H,(H,32,34)(H,33,35) |
| InChIK | GBLNXETVVXRUDM-UHFFFAOYSA-N |
| TotalMolweight | 540.416 |
| Molweight | 540.416 |
| MonoisotopicMass | 539.084453 |
| CLogP | 7.139 |
| CLogS | -8.072 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 395.25 |
| Relative PSA | 0.18879 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 6.305 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(2Z,4E)-1-[(2Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide | 2 - N-[(2Z,4E)-1-[(2Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide