| MolName | 4-amino-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C17H12N5O3BrCl2 |
| Smiles | Nc1nonc1C(N/N=C\c(cc(cc1)Br)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C17H12BrCl2N5O3/c18-11-2-4-14(27-8-9-1-3-12(19)6-13(9)20)10(5-11)7-22-23-17(26)15-16(21)25-28-24-15/h1-7H,8H2,(H2,21,25)(H,23,26) |
| InChIK | GBPWXYYHPNQYFV-UHFFFAOYSA-N |
| TotalMolweight | 485.124 |
| Molweight | 485.124 |
| MonoisotopicMass | 482.950055 |
| CLogP | 4.7263 |
| CLogS | -6.236 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 315.71 |
| Relative PSA | 0.30829 |
| PolarSurfaceArea | 115.63 |
| Druglikeness | 4.2105 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide