| MolName | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
| MolecularFormula | C27H21N2O4Cl |
| Smiles | O=C(Cc(cc1)cc2c1OCO2)N/N=C\c(c1ccccc1cc1)c1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C27H21ClN2O4/c28-21-9-5-18(6-10-21)16-32-24-12-8-20-3-1-2-4-22(20)23(24)15-29-30-27(31)14-19-7-11-25-26(13-19)34-17-33-25/h1-13,15H,14,16-17H2,(H,30,31) |
| InChIK | GCLJABVCXSCREA-UHFFFAOYSA-N |
| TotalMolweight | 472.927 |
| Molweight | 472.927 |
| MonoisotopicMass | 472.118985 |
| CLogP | 6.4596 |
| CLogS | -8.08 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 354.55 |
| Relative PSA | 0.18618 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 4.0051 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide | 2 - 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide