| MolName | N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C20H21N5O3S |
| Smiles | Cc(cc1)ccc1-c(n1C)nnc1SCC(NN=Cc(cc1)cc(OC)c1O)=O |
| InChI | InChI=1S/C20H21N5O3S/c1-13-4-7-15(8-5-13)19-23-24-20(25(19)2)29-12-18(27)22-21-11-14-6-9-16(26)17(10-14)28-3/h4-11,26H,12H2,1-3H3,(H,22,27) |
| InChIK | GCLQDPKLULCGGJ-UHFFFAOYSA-N |
| TotalMolweight | 411.485 |
| Molweight | 411.485 |
| MonoisotopicMass | 411.13651 |
| CLogP | 3.1304 |
| CLogS | -4.856 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 317.85 |
| Relative PSA | 0.33163 |
| PolarSurfaceArea | 126.93 |
| Druglikeness | 6.0281 |
| Mutagenic | none |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide