| MolName | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-3-phenylpropylideneamino]propanamide |
| MolecularFormula | C15H17N5O3 |
| Smiles | O=C(CCC(C(N1)=O)=NNC1=O)N/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C15H17N5O3/c21-13(9-8-12-14(22)17-15(23)20-18-12)19-16-10-4-7-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,19,21)(H2,17,20,22,23) |
| InChIK | GDBRUERZKJYYBC-UHFFFAOYSA-N |
| TotalMolweight | 315.332 |
| Molweight | 315.332 |
| MonoisotopicMass | 315.13314 |
| CLogP | 1.0696 |
| CLogS | -3.788 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 250.16 |
| Relative PSA | 0.38583 |
| PolarSurfaceArea | 112.02 |
| Druglikeness | 5.9054 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-3-phenylpropylideneamino]propanamide | 2 - 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-3-phenylpropylideneamino]propanamide