| MolName | 2-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C14H11N3O5 |
| Smiles | [O-][N+](c1ccc(/C=C/C=N\NC(c(cccc2)c2O)=O)o1)=O |
| InChI | InChI=1S/C14H11N3O5/c18-12-6-2-1-5-11(12)14(19)16-15-9-3-4-10-7-8-13(22-10)17(20)21/h1-9,18H,(H,16,19) |
| InChIK | GDJKBXUMODJKPF-UHFFFAOYSA-N |
| TotalMolweight | 301.257 |
| Molweight | 301.257 |
| MonoisotopicMass | 301.069872 |
| CLogP | 1.4927 |
| CLogS | -4.384 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 233.2 |
| Relative PSA | 0.40154 |
| PolarSurfaceArea | 120.65 |
| Druglikeness | 1.1143 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]benzamide | 2 - 2-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]benzamide