| MolName | 2-[4-[(Z)-(benzenesulfonylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide |
| MolecularFormula | C21H19N3O4S |
| Smiles | O=C(COc1ccc(/C=N\NS(c2ccccc2)(=O)=O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H19N3O4S/c25-21(23-18-7-3-1-4-8-18)16-28-19-13-11-17(12-14-19)15-22-24-29(26,27)20-9-5-2-6-10-20/h1-15,24H,16H2,(H,23,25) |
| InChIK | GDPGYKJNVQUCJC-UHFFFAOYSA-N |
| TotalMolweight | 409.465 |
| Molweight | 409.465 |
| MonoisotopicMass | 409.109627 |
| CLogP | 2.9995 |
| CLogS | -3.208 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 310.55 |
| Relative PSA | 0.27709 |
| PolarSurfaceArea | 105.24 |
| Druglikeness | -3.9828 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-(benzenesulfonylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide | 2 - 2-[4-[(Z)-(benzenesulfonylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide