| MolName | N-[2-oxo-2-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C19H17N3O4 |
| Smiles | O=C(CNC(c(cc1)cc2c1OCO2)=O)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C19H17N3O4/c23-18(22-21-10-4-7-14-5-2-1-3-6-14)12-20-19(24)15-8-9-16-17(11-15)26-13-25-16/h1-11H,12-13H2,(H,20,24)(H,22,23) |
| InChIK | GDWLNGKQZSKQPZ-UHFFFAOYSA-N |
| TotalMolweight | 351.361 |
| Molweight | 351.361 |
| MonoisotopicMass | 351.121907 |
| CLogP | 2.415 |
| CLogS | -4.491 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 276.72 |
| Relative PSA | 0.29094 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 5.27 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-oxo-2-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]-1,3-benzodioxole-5-carboxamide | 2 - N-[2-oxo-2-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]-1,3-benzodioxole-5-carboxamide