| MolName | 4-[(2Z)-2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid |
| MolecularFormula | C15H8N3O4Cl3F4 |
| Smiles | OC(c(nc(c(Cl)c1N/N=C\c(ccc(OC(F)F)c2)c2OC(F)F)Cl)c1Cl)=O |
| InChI | InChI=1S/C15H8Cl3F4N3O4/c16-8-10(9(17)12(18)24-11(8)13(26)27)25-23-4-5-1-2-6(28-14(19)20)3-7(5)29-15(21)22/h1-4,14-15H,(H,24,25)(H,26,27) |
| InChIK | GEDDOLAQZQXCDK-UHFFFAOYSA-N |
| TotalMolweight | 476.597 |
| Molweight | 476.597 |
| MonoisotopicMass | 474.95165 |
| CLogP | 5.4629 |
| CLogS | -5.606 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 308.76 |
| Relative PSA | 0.25936 |
| PolarSurfaceArea | 93.04 |
| Druglikeness | -0.88877 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid | 2 - 4-[(2Z)-2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid