| MolName | N-[(Z)-(3-phenoxyphenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| MolecularFormula | C18H16N2O4 |
| Smiles | O=C(C1=COCCO1)N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C18H16N2O4/c21-18(17-13-22-9-10-23-17)20-19-12-14-5-4-8-16(11-14)24-15-6-2-1-3-7-15/h1-8,11-13H,9-10H2,(H,20,21) |
| InChIK | GEJABGQPYRDWIN-UHFFFAOYSA-N |
| TotalMolweight | 324.335 |
| Molweight | 324.335 |
| MonoisotopicMass | 324.111008 |
| CLogP | 2.3097 |
| CLogS | -5.168 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 255.72 |
| Relative PSA | 0.25813 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | -2.7823 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide | 2 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide