| MolName | N-[(Z)-(3-chlorophenyl)methylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C11H11N2OCl |
| Smiles | O=C(C1CC1)N/N=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O/c12-10-3-1-2-8(6-10)7-13-14-11(15)9-4-5-9/h1-3,6-7,9H,4-5H2,(H,14,15) |
| InChIK | GEMJDMGKXKBYPQ-UHFFFAOYSA-N |
| TotalMolweight | 222.674 |
| Molweight | 222.674 |
| MonoisotopicMass | 222.05599 |
| CLogP | 2.6819 |
| CLogS | -3.803 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 169.17 |
| Relative PSA | 0.21286 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.7359 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-chlorophenyl)methylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-(3-chlorophenyl)methylideneamino]cyclopropanecarboxamide