| MolName | 2,6-bis(azepan-1-yl)-N-[(Z)-pyridin-4-ylmethylideneamino]pyrimidin-4-amine |
| MolecularFormula | C22H31N7 |
| Smiles | C(CCC1)CCN1c1cc(N/N=C\c2ccncc2)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C22H31N7/c1-2-6-14-28(13-5-1)21-17-20(27-24-18-19-9-11-23-12-10-19)25-22(26-21)29-15-7-3-4-8-16-29/h9-12,17-18H,1-8,13-16H2,(H,25,26,27) |
| InChIK | GEMSGFRQNIECHO-UHFFFAOYSA-N |
| TotalMolweight | 393.537 |
| Molweight | 393.537 |
| MonoisotopicMass | 393.264093 |
| CLogP | 5.6991 |
| CLogS | -5.195 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 324.24 |
| Relative PSA | 0.19424 |
| PolarSurfaceArea | 69.54 |
| Druglikeness | 0.31944 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-bis(azepan-1-yl)-N-[(Z)-pyridin-4-ylmethylideneamino]pyrimidin-4-amine | 2 - 2,6-bis(azepan-1-yl)-N-[(Z)-pyridin-4-ylmethylideneamino]pyrimidin-4-amine