| MolName | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| MolecularFormula | C19H16N5O2Cl2F |
| Smiles | Fc1c(N2CCOCC2)nc(N/N=C\c2ccc(-c(ccc(Cl)c3)c3Cl)o2)nc1 |
| InChI | InChI=1S/C19H16Cl2FN5O2/c20-12-1-3-14(15(21)9-12)17-4-2-13(29-17)10-24-26-19-23-11-16(22)18(25-19)27-5-7-28-8-6-27/h1-4,9-11H,5-8H2,(H,23,25,26) |
| InChIK | GFGGBGMYWFZWQG-UHFFFAOYSA-N |
| TotalMolweight | 436.273 |
| Molweight | 436.273 |
| MonoisotopicMass | 435.066507 |
| CLogP | 5.9193 |
| CLogS | -6.29 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 315.24 |
| Relative PSA | 0.23021 |
| PolarSurfaceArea | 75.78 |
| Druglikeness | 3.8583 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine | 2 - N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine