| MolName | N-[(Z)-furan-2-ylmethylideneamino]-3-(2-hydroxyphenyl)propanamide |
| MolecularFormula | C14H14N2O3 |
| Smiles | Oc1c(CCC(N/N=C\c2ccco2)=O)cccc1 |
| InChI | InChI=1S/C14H14N2O3/c17-13-6-2-1-4-11(13)7-8-14(18)16-15-10-12-5-3-9-19-12/h1-6,9-10,17H,7-8H2,(H,16,18) |
| InChIK | GFGQEFNPDDDEHU-UHFFFAOYSA-N |
| TotalMolweight | 258.276 |
| Molweight | 258.276 |
| MonoisotopicMass | 258.100443 |
| CLogP | 2.4971 |
| CLogS | -3.342 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 210.55 |
| Relative PSA | 0.30026 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 3.1165 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-3-(2-hydroxyphenyl)propanamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-3-(2-hydroxyphenyl)propanamide