| MolName | (E,Z)-2-chloro-3-(4-nitrophenyl)-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| MolecularFormula | C11H8N5O2Cl |
| Smiles | [O-][N+](c1ccc(/C=C(/C=N/n2cnnc2)\Cl)cc1)=O |
| InChI | InChI=1S/C11H8ClN5O2/c12-10(6-15-16-7-13-14-8-16)5-9-1-3-11(4-2-9)17(18)19/h1-8H |
| InChIK | GFYJXFISAJVUMU-UHFFFAOYSA-N |
| TotalMolweight | 277.671 |
| Molweight | 277.671 |
| MonoisotopicMass | 277.036652 |
| CLogP | 0.7866 |
| CLogS | -5.753 |
| H Acceptors | 7 |
| TotalSurfaceArea | 208.3 |
| Relative PSA | 0.33961 |
| PolarSurfaceArea | 88.89 |
| Druglikeness | -1.4432 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E,Z)-2-chloro-3-(4-nitrophenyl)-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine | 2 - (E,Z)-2-chloro-3-(4-nitrophenyl)-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine