| MolName | 2,4-dichloro-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C25H18N2O2Cl2 |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)N/N=C\c(cc1)ccc1OCc1cc2ccccc2cc1 |
| InChI | InChI=1S/C25H18Cl2N2O2/c26-21-9-12-23(24(27)14-21)25(30)29-28-15-17-6-10-22(11-7-17)31-16-18-5-8-19-3-1-2-4-20(19)13-18/h1-15H,16H2,(H,29,30) |
| InChIK | GGDMVODBYOKODM-UHFFFAOYSA-N |
| TotalMolweight | 449.336 |
| Molweight | 449.336 |
| MonoisotopicMass | 448.074532 |
| CLogP | 6.9561 |
| CLogS | -8.14 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 335.95 |
| Relative PSA | 0.13695 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.0514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dichloro-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]benzamide | 2 - 2,4-dichloro-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]benzamide