| MolName | N-[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C25H28N7OBr |
| Smiles | Brc(cc1)cc(/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)n2)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H28BrN7O/c26-21-10-11-22(34-18-19-8-2-1-3-9-19)20(16-21)17-27-31-23-28-24(32-12-4-5-13-32)30-25(29-23)33-14-6-7-15-33/h1-3,8-11,16-17H,4-7,12-15,18H2,(H,28,29,30,31) |
| InChIK | GGOBBBNNGOEBQH-UHFFFAOYSA-N |
| TotalMolweight | 522.449 |
| Molweight | 522.449 |
| MonoisotopicMass | 521.153869 |
| CLogP | 7.3178 |
| CLogS | -6.954 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 371.35 |
| Relative PSA | 0.19653 |
| PolarSurfaceArea | 78.77 |
| Druglikeness | 1.8743 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 11 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine