| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]dodec-11-enamide |
| MolecularFormula | C19H26N2OCl2 |
| Smiles | C=CCCCCCCCCCC(N/N=C\c(c(Cl)ccc1)c1Cl)=O |
| InChI | InChI=1S/C19H26Cl2N2O/c1-2-3-4-5-6-7-8-9-10-14-19(24)23-22-15-16-17(20)12-11-13-18(16)21/h2,11-13,15H,1,3-10,14H2,(H,23,24) |
| InChIK | GHALRBJTGKKISU-UHFFFAOYSA-N |
| TotalMolweight | 369.334 |
| Molweight | 369.334 |
| MonoisotopicMass | 368.142217 |
| CLogP | 7.3283 |
| CLogS | -6.662 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 306.45 |
| Relative PSA | 0.11751 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | -11.289 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.79167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 12 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 9 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]dodec-11-enamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]dodec-11-enamide