| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[2-(4-bromophenoxy)ethoxy]-5-chlorophenyl]methylideneamino]acetamide |
| MolecularFormula | C19H17N5O3BrClS |
| Smiles | Nc1nnc(CC(N/N=C\c(cc(cc2)Cl)c2OCCOc(cc2)ccc2Br)=O)s1 |
| InChI | InChI=1S/C19H17BrClN5O3S/c20-13-1-4-15(5-2-13)28-7-8-29-16-6-3-14(21)9-12(16)11-23-24-17(27)10-18-25-26-19(22)30-18/h1-6,9,11H,7-8,10H2,(H2,22,26)(H,24,27) |
| InChIK | GHJKXLWJPCXJOV-UHFFFAOYSA-N |
| TotalMolweight | 510.799 |
| Molweight | 510.799 |
| MonoisotopicMass | 508.992398 |
| CLogP | 4.0516 |
| CLogS | -5.807 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 344.06 |
| Relative PSA | 0.33012 |
| PolarSurfaceArea | 139.96 |
| Druglikeness | -3.1296 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[2-(4-bromophenoxy)ethoxy]-5-chlorophenyl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[2-(4-bromophenoxy)ethoxy]-5-chlorophenyl]methylideneamino]acetamide