| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C17H15N4ClS |
| Smiles | Clc1c(/C=N\Nc2ncnc3c2c(CCCC2)c2s3)cccc1 |
| InChI | InChI=1S/C17H15ClN4S/c18-13-7-3-1-5-11(13)9-21-22-16-15-12-6-2-4-8-14(12)23-17(15)20-10-19-16/h1,3,5,7,9-10H,2,4,6,8H2,(H,19,20,22) |
| InChIK | GHOAAQNTMSUFIF-UHFFFAOYSA-N |
| TotalMolweight | 342.853 |
| Molweight | 342.853 |
| MonoisotopicMass | 342.070593 |
| CLogP | 6.5095 |
| CLogS | -6.574 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 254.26 |
| Relative PSA | 0.25671 |
| PolarSurfaceArea | 78.41 |
| Druglikeness | -1.3257 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine