| MolName | N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| MolecularFormula | C21H10N2OBrCl2F7 |
| Smiles | FC(c(c(F)c(c(N/N=C\c(cc(cc1)Br)c1OCc(ccc(Cl)c1)c1Cl)c1F)F)c1F)(F)F |
| InChI | InChI=1S/C21H10BrCl2F7N2O/c22-11-2-4-14(34-8-9-1-3-12(23)6-13(9)24)10(5-11)7-32-33-20-18(27)16(25)15(21(29,30)31)17(26)19(20)28/h1-7,33H,8H2 |
| InChIK | GHWFOOWEBSNKDG-UHFFFAOYSA-N |
| TotalMolweight | 590.119 |
| Molweight | 590.119 |
| MonoisotopicMass | 587.924174 |
| CLogP | 9.3777 |
| CLogS | -8.83 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 357.09 |
| Relative PSA | 0.09233 |
| PolarSurfaceArea | 33.62 |
| Druglikeness | -7.3075 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline | 2 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline