| MolName | [1-[(Z)-(naphthalen-2-ylsulfonylhydrazinylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
| MolecularFormula | C32H22N2O4S |
| Smiles | O=C(c1cccc2ccccc12)Oc1c(/C=N\NS(c2cc3ccccc3cc2)(=O)=O)c2ccccc2cc1 |
| InChI | InChI=1S/C32H22N2O4S/c35-32(29-15-7-12-23-9-3-5-13-27(23)29)38-31-19-17-24-10-4-6-14-28(24)30(31)21-33-34-39(36,37)26-18-16-22-8-1-2-11-25(22)20-26/h1-21,34H |
| InChIK | GIFHZIMAFLWVSI-UHFFFAOYSA-N |
| TotalMolweight | 530.603 |
| Molweight | 530.603 |
| MonoisotopicMass | 530.130028 |
| CLogP | 7.2908 |
| CLogS | -8.204 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 389.13 |
| Relative PSA | 0.19168 |
| PolarSurfaceArea | 93.21 |
| Druglikeness | -1.381 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 2 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-(naphthalen-2-ylsulfonylhydrazinylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate | 2 - [1-[(Z)-(naphthalen-2-ylsulfonylhydrazinylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate