| MolName | N-[(Z)-[2-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C27H19N3O4S |
| Smiles | [O-][N+](c(cc1)cc2c1sc(C(N/N=C\c(cccc1)c1OCc1cc3ccccc3cc1)=O)c2)=O |
| InChI | InChI=1S/C27H19N3O4S/c31-27(26-15-22-14-23(30(32)33)11-12-25(22)35-26)29-28-16-21-7-3-4-8-24(21)34-17-18-9-10-19-5-1-2-6-20(19)13-18/h1-16H,17H2,(H,29,31) |
| InChIK | GIJOPNWRNFBQOH-UHFFFAOYSA-N |
| TotalMolweight | 481.531 |
| Molweight | 481.531 |
| MonoisotopicMass | 481.109627 |
| CLogP | 5.7437 |
| CLogS | -8.477 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 359.32 |
| Relative PSA | 0.26937 |
| PolarSurfaceArea | 124.75 |
| Druglikeness | 0.38073 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-[2-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide