| MolName | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
| MolecularFormula | C28H29N7Cl2 |
| Smiles | Clc1cc(Cl)c(Cn2c(cccc3)c3c(/C=N\Nc3nc(N4CCCC4)nc(N4CCCC4)c3)c2)cc1 |
| InChI | InChI=1S/C28H29Cl2N7/c29-22-10-9-20(24(30)15-22)18-37-19-21(23-7-1-2-8-25(23)37)17-31-34-26-16-27(35-11-3-4-12-35)33-28(32-26)36-13-5-6-14-36/h1-2,7-10,15-17,19H,3-6,11-14,18H2,(H,32,33,34) |
| InChIK | GIWFMBCOMPYLSA-UHFFFAOYSA-N |
| TotalMolweight | 534.493 |
| Molweight | 534.493 |
| MonoisotopicMass | 533.186147 |
| CLogP | 8.0737 |
| CLogS | -7.36 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 398.6 |
| Relative PSA | 0.14772 |
| PolarSurfaceArea | 61.58 |
| Druglikeness | 4.4285 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48649 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine | 2 - N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine