| MolName | ethyl 2-[[2-[(2Z)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| MolecularFormula | C19H17N3O4Cl2S |
| Smiles | CCOC(c1c(NC(C(N/N=C\c2cccc(Cl)c2Cl)=O)=O)sc2c1CCC2)=O |
| InChI | InChI=1S/C19H17Cl2N3O4S/c1-2-28-19(27)14-11-6-4-8-13(11)29-18(14)23-16(25)17(26)24-22-9-10-5-3-7-12(20)15(10)21/h3,5,7,9H,2,4,6,8H2,1H3,(H,23,25)(H,24,26) |
| InChIK | GJUMICPINBCQKY-UHFFFAOYSA-N |
| TotalMolweight | 454.333 |
| Molweight | 454.333 |
| MonoisotopicMass | 453.031681 |
| CLogP | 4.5462 |
| CLogS | -6.42 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 324.53 |
| Relative PSA | 0.32019 |
| PolarSurfaceArea | 125.1 |
| Druglikeness | -1.0761 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - ethyl 2-[[2-[(2Z)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate | 2 - ethyl 2-[[2-[(2Z)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate