| MolName | 4-(2,4-dichlorophenoxy)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]butanamide |
| MolecularFormula | C17H14N2O2Cl4 |
| Smiles | O=C(CCCOc(ccc(Cl)c1)c1Cl)N/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl4N2O2/c18-12-6-7-15(14(20)9-12)25-8-2-5-16(24)23-22-10-11-3-1-4-13(19)17(11)21/h1,3-4,6-7,9-10H,2,5,8H2,(H,23,24) |
| InChIK | GKAFTBQVQPGCSW-UHFFFAOYSA-N |
| TotalMolweight | 420.122 |
| Molweight | 420.122 |
| MonoisotopicMass | 417.980936 |
| CLogP | 6.1093 |
| CLogS | -6.985 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 299.95 |
| Relative PSA | 0.15339 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 0.089105 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,4-dichlorophenoxy)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]butanamide | 2 - 4-(2,4-dichlorophenoxy)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]butanamide