| MolName | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(Z)-(2-chlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C17H17N2O3ClS2 |
| Smiles | O=C(CSCCS(c1ccccc1)(=O)=O)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C17H17ClN2O3S2/c18-16-9-5-4-6-14(16)12-19-20-17(21)13-24-10-11-25(22,23)15-7-2-1-3-8-15/h1-9,12H,10-11,13H2,(H,20,21) |
| InChIK | GKIHFJVSNYPHPP-UHFFFAOYSA-N |
| TotalMolweight | 396.918 |
| Molweight | 396.918 |
| MonoisotopicMass | 396.03691 |
| CLogP | 3.1914 |
| CLogS | -5.175 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 289.76 |
| Relative PSA | 0.28327 |
| PolarSurfaceArea | 109.28 |
| Druglikeness | -11.882 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(Z)-(2-chlorophenyl)methylideneamino]acetamide | 2 - 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(Z)-(2-chlorophenyl)methylideneamino]acetamide