| MolName | N-[(Z)-thiophen-2-ylmethylideneamino]-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]benzamide |
| MolecularFormula | C17H14N4OS2 |
| Smiles | O=C(c1cccc(N/N=C\c2cccs2)c1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C17H14N4OS2/c22-17(21-19-12-16-7-3-9-24-16)13-4-1-5-14(10-13)20-18-11-15-6-2-8-23-15/h1-12,20H,(H,21,22) |
| InChIK | GKPSZLQFTANNDW-UHFFFAOYSA-N |
| TotalMolweight | 354.457 |
| Molweight | 354.457 |
| MonoisotopicMass | 354.060901 |
| CLogP | 6.1161 |
| CLogS | -5.274 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 274.85 |
| Relative PSA | 0.36274 |
| PolarSurfaceArea | 122.33 |
| Druglikeness | 5.979 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-2-ylmethylideneamino]-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]benzamide | 2 - N-[(Z)-thiophen-2-ylmethylideneamino]-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]benzamide