| MolName | N-[(Z)-benzylideneamino]-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide |
| MolecularFormula | C20H26N4O |
| Smiles | O=C(C[NH+]1CC[NH+](Cc2ccccc2)CC1)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C20H24N4O/c25-20(22-21-15-18-7-3-1-4-8-18)17-24-13-11-23(12-14-24)16-19-9-5-2-6-10-19/h1-10,15H,11-14,16-17H2,(H,22,25)/p+2 |
| InChIK | GKTAHEIFHHAQAK-UHFFFAOYSA-P |
| TotalMolweight | 338.453 |
| Molweight | 338.453 |
| MonoisotopicMass | 338.210661 |
| CLogP | -1.6716 |
| CLogS | -2.566 |
| H Acceptors | 5 |
| H Donors | 3 |
| TotalSurfaceArea | 304.73 |
| Relative PSA | 0.23362 |
| PolarSurfaceArea | 50.34 |
| Druglikeness | 4.067 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide | 2 - N-[(Z)-benzylideneamino]-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide