| MolName | 4-bromo-N-[(Z)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]benzenesulfonamide |
| MolecularFormula | C18H12N2O4BrCl3S |
| Smiles | O=S(c(cc1)ccc1Br)(N/N=C\c1ccc(COc(c(Cl)cc(Cl)c2)c2Cl)o1)=O |
| InChI | InChI=1S/C18H12BrCl3N2O4S/c19-11-1-5-15(6-2-11)29(25,26)24-23-9-13-3-4-14(28-13)10-27-18-16(21)7-12(20)8-17(18)22/h1-9,24H,10H2 |
| InChIK | GKYGYDAOFXVAIQ-UHFFFAOYSA-N |
| TotalMolweight | 538.632 |
| Molweight | 538.632 |
| MonoisotopicMass | 535.87667 |
| CLogP | 5.4111 |
| CLogS | -6.005 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 335.92 |
| Relative PSA | 0.22523 |
| PolarSurfaceArea | 89.28 |
| Druglikeness | 1.4818 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-N-[(Z)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]benzenesulfonamide | 2 - 4-bromo-N-[(Z)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]benzenesulfonamide