| MolName | (1S,2R,6S,7R)-4-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| MolecularFormula | C25H19N3O2Cl2 |
| Smiles | O=C([C@H]([C@@H]1C=C[C@H]2C1)[C@H]2C1=O)N1/N=C\c1cn(Cc(cc2)cc(Cl)c2Cl)c2c1cccc2 |
| InChI | InChI=1S/C25H19Cl2N3O2/c26-19-8-5-14(9-20(19)27)12-29-13-17(18-3-1-2-4-21(18)29)11-28-30-24(31)22-15-6-7-16(10-15)23(22)25(30)32/h1-9,11,13,15-16,22-23H,10,12H2/t15-,16-,22-,23+/m0/s1 |
| InChIK | GKYIPPSGDCFEDA-PCNTZYQVSA-N |
| TotalMolweight | 464.351 |
| Molweight | 464.351 |
| MonoisotopicMass | 463.085431 |
| CLogP | 4.4802 |
| CLogS | -5.718 |
| H Acceptors | 5 |
| TotalSurfaceArea | 321.74 |
| Relative PSA | 0.14922 |
| PolarSurfaceArea | 54.67 |
| Druglikeness | 6.0076 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1S,2R,6S,7R)-4-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione | 2 - (1S,2R,6S,7R)-4-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione