| MolName | 2-hydroxy-2,2-diphenyl-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C25H17N2O3Cl3 |
| Smiles | OC(C(N/N=C\c1ccc(-c(c(Cl)c2)cc(Cl)c2Cl)o1)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H17Cl3N2O3/c26-20-14-22(28)21(27)13-19(20)23-12-11-18(33-23)15-29-30-24(31)25(32,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,32H,(H,30,31) |
| InChIK | GLHDDBFCGLQSIV-UHFFFAOYSA-N |
| TotalMolweight | 499.78 |
| Molweight | 499.78 |
| MonoisotopicMass | 498.030474 |
| CLogP | 6.2388 |
| CLogS | -8.095 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 359.22 |
| Relative PSA | 0.17599 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 7.4419 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-2,2-diphenyl-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-hydroxy-2,2-diphenyl-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide