| MolName | 4-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate |
| MolecularFormula | C16H11N4O2S |
| Smiles | [O-]C(c1ccc(/C=N\N(C(c2ccccc2)=NN2)C2=S)cc1)=O |
| InChI | InChI=1S/C16H12N4O2S/c21-15(22)13-8-6-11(7-9-13)10-17-20-14(18-19-16(20)23)12-4-2-1-3-5-12/h1-10H,(H,19,23)(H,21,22)/p-1 |
| InChIK | GLZSDIMNGWESIQ-UHFFFAOYSA-M |
| TotalMolweight | 323.355 |
| Molweight | 323.355 |
| MonoisotopicMass | 323.060271 |
| CLogP | 0.7041 |
| CLogS | -4.464 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 247 |
| Relative PSA | 0.37794 |
| PolarSurfaceArea | 112.21 |
| Druglikeness | 3.6216 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate | 2 - 4-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate