| MolName | N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-phenylphenoxy)acetamide |
| MolecularFormula | C25H18N2O3Cl2 |
| Smiles | O=C(COc(cccc1)c1-c1ccccc1)N/N=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H18Cl2N2O3/c26-21-11-6-10-20(25(21)27)23-14-13-18(32-23)15-28-29-24(30)16-31-22-12-5-4-9-19(22)17-7-2-1-3-8-17/h1-15H,16H2,(H,29,30) |
| InChIK | GLZUEOSTWNWSCO-UHFFFAOYSA-N |
| TotalMolweight | 465.335 |
| Molweight | 465.335 |
| MonoisotopicMass | 464.069447 |
| CLogP | 6.5866 |
| CLogS | -8.519 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 350.8 |
| Relative PSA | 0.17138 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 6.4337 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-phenylphenoxy)acetamide | 2 - N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-phenylphenoxy)acetamide