| MolName | (Z)-4-(2,4-dichlorophenyl)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4-difluorophenyl)-1,3-thiazol-2-imine |
| MolecularFormula | C22H11N3Cl4F2S |
| Smiles | Fc(cc1)cc(F)c1/N=C1\SC=C(c(ccc(Cl)c2)c2Cl)N1/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C22H11Cl4F2N3S/c23-13-2-1-12(17(25)7-13)10-29-31-21(16-5-3-14(24)8-18(16)26)11-32-22(31)30-20-6-4-15(27)9-19(20)28/h1-11H |
| InChIK | GMGIKPAYHZYEGA-UHFFFAOYSA-N |
| TotalMolweight | 529.224 |
| Molweight | 529.224 |
| MonoisotopicMass | 526.939581 |
| CLogP | 7.9897 |
| CLogS | -9.206 |
| H Acceptors | 3 |
| TotalSurfaceArea | 353.89 |
| Relative PSA | 0.1245 |
| PolarSurfaceArea | 53.26 |
| Druglikeness | 2.6726 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-4-(2,4-dichlorophenyl)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4-difluorophenyl)-1,3-thiazol-2-imine | 2 - (Z)-4-(2,4-dichlorophenyl)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4-difluorophenyl)-1,3-thiazol-2-imine