| MolName | [4-bromo-2-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C18H11N3O4Br2 |
| Smiles | O=C(c1ccco1)Oc(cc1)c(/C=N\NC(c2cc(Br)cnc2)=O)cc1Br |
| InChI | InChI=1S/C18H11Br2N3O4/c19-13-3-4-15(27-18(25)16-2-1-5-26-16)11(6-13)9-22-23-17(24)12-7-14(20)10-21-8-12/h1-10H,(H,23,24) |
| InChIK | GMGNPCIBRZDYEU-UHFFFAOYSA-N |
| TotalMolweight | 493.11 |
| Molweight | 493.11 |
| MonoisotopicMass | 490.911629 |
| CLogP | 4.2703 |
| CLogS | -5.746 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 300.21 |
| Relative PSA | 0.28024 |
| PolarSurfaceArea | 93.79 |
| Druglikeness | 2.4127 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-bromo-2-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate