| MolName | (Z)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C24H23N3O |
| Smiles | C(COCC1)N1c1ccc(/C=N\N=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O/c1-3-7-21(8-4-1)24(22-9-5-2-6-10-22)26-25-19-20-11-13-23(14-12-20)27-15-17-28-18-16-27/h1-14,19H,15-18H2 |
| InChIK | GMLOVVCMDXZYKF-UHFFFAOYSA-N |
| TotalMolweight | 369.467 |
| Molweight | 369.467 |
| MonoisotopicMass | 369.184112 |
| CLogP | 5.6513 |
| CLogS | -6.011 |
| H Acceptors | 4 |
| TotalSurfaceArea | 302.35 |
| Relative PSA | 0.12095 |
| PolarSurfaceArea | 37.19 |
| Druglikeness | 3.1828 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 12 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,1-diphenylmethanimine