| MolName | 3-(2-bromophenyl)-4-[(Z)-(3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H11N4OBrS |
| Smiles | Oc1cccc(/C=N\N(C(c(cccc2)c2Br)=NN2)C2=S)c1 |
| InChI | InChI=1S/C15H11BrN4OS/c16-13-7-2-1-6-12(13)14-18-19-15(22)20(14)17-9-10-4-3-5-11(21)8-10/h1-9,21H,(H,19,22) |
| InChIK | GMSMFZAHESUCIL-UHFFFAOYSA-N |
| TotalMolweight | 375.249 |
| Molweight | 375.249 |
| MonoisotopicMass | 373.983692 |
| CLogP | 3.6745 |
| CLogS | -4.989 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 246.7 |
| Relative PSA | 0.32075 |
| PolarSurfaceArea | 92.31 |
| Druglikeness | 1.7119 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2-bromophenyl)-4-[(Z)-(3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2-bromophenyl)-4-[(Z)-(3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione