| MolName | 4-chloro-N-[(2S)-2-[[4-[(Z)-(3-nitrophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-2-phenylethyl]benzenesulfonamide |
| MolecularFormula | C23H19N6O4ClS2 |
| Smiles | [O-][N+](c1cccc(/C=N\n2c(S[C@H](CNS(c(cc3)ccc3Cl)(=O)=O)c3ccccc3)nnc2)c1)=O |
| InChI | InChI=1S/C23H19ClN6O4S2/c24-19-9-11-21(12-10-19)36(33,34)27-15-22(18-6-2-1-3-7-18)35-23-28-25-16-29(23)26-14-17-5-4-8-20(13-17)30(31)32/h1-14,16,22,27H,15H2/t22-/m1/s1 |
| InChIK | GMXGBOHEHIOPQE-JOCHJYFZSA-N |
| TotalMolweight | 543.027 |
| Molweight | 543.027 |
| MonoisotopicMass | 542.059771 |
| CLogP | 4.202 |
| CLogS | -7.966 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 386.9 |
| Relative PSA | 0.33153 |
| PolarSurfaceArea | 168.74 |
| Druglikeness | 2.161 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| StereoCenters | 1 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 4-chloro-N-[(2S)-2-[[4-[(Z)-(3-nitrophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-2-phenylethyl]benzenesulfonamide | 2 - 4-chloro-N-[(2S)-2-[[4-[(Z)-(3-nitrophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-2-phenylethyl]benzenesulfonamide