| MolName | [2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-fluorophenoxy)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate |
| MolecularFormula | C26H18N8O5BrF |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc(cc2)Br)c2OC(c2ccccc2)=O)=O)c1COc(cc1)ccc1F |
| InChI | InChI=1S/C26H18BrFN8O5/c27-17-6-11-21(40-26(38)15-4-2-1-3-5-15)16(12-17)13-30-32-25(37)22-20(14-39-19-9-7-18(28)8-10-19)36(35-31-22)24-23(29)33-41-34-24/h1-13H,14H2,(H2,29,33)(H,32,37) |
| InChIK | GMYGIGFEFJGDAX-UHFFFAOYSA-N |
| TotalMolweight | 621.382 |
| Molweight | 621.382 |
| MonoisotopicMass | 620.056756 |
| CLogP | 5.354 |
| CLogS | -5.411 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 425.21 |
| Relative PSA | 0.35084 |
| PolarSurfaceArea | 172.64 |
| Druglikeness | -1.543 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-fluorophenoxy)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate | 2 - [2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-fluorophenoxy)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate