| MolName | 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H13N7O5F6 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N/N=C\c(cc2)cc3c2OCO3)n1)=O |
| InChI | InChI=1S/C20H13F6N7O5/c21-19(22,23)15(20(24,25)26)38-18-30-16(28-11-2-4-12(5-3-11)33(34)35)29-17(31-18)32-27-8-10-1-6-13-14(7-10)37-9-36-13/h1-8,15H,9H2,(H2,28,29,30,31,32) |
| InChIK | GNGAFMCGGRNWGM-UHFFFAOYSA-N |
| TotalMolweight | 545.355 |
| Molweight | 545.355 |
| MonoisotopicMass | 545.088236 |
| CLogP | 6.6469 |
| CLogS | -8.26 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 362.09 |
| Relative PSA | 0.35284 |
| PolarSurfaceArea | 148.6 |
| Druglikeness | -14.902 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.47368 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine