| MolName | [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C24H15N3O6Br2 |
| Smiles | N#Cc(cccc1)c1OCC(N/N=C\c1cc(Br)cc(Br)c1OC(c(cc1)cc2c1OCO2)=O)=O |
| InChI | InChI=1S/C24H15Br2N3O6/c25-17-7-16(11-28-29-22(30)12-32-19-4-2-1-3-15(19)10-27)23(18(26)9-17)35-24(31)14-5-6-20-21(8-14)34-13-33-20/h1-9,11H,12-13H2,(H,29,30) |
| InChIK | GNKHSVJRMUWFIH-UHFFFAOYSA-N |
| TotalMolweight | 601.206 |
| Molweight | 601.206 |
| MonoisotopicMass | 598.932759 |
| CLogP | 5.6044 |
| CLogS | -8.123 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 377.49 |
| Relative PSA | 0.27182 |
| PolarSurfaceArea | 119.24 |
| Druglikeness | -2.1329 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate