| MolName | 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C18H13N5O5 |
| Smiles | [O-][N+](c1cc(/C=N\NC(c2cc(-c(cc3)cc4c3OCO4)n[nH]2)=O)ccc1)=O |
| InChI | InChI=1S/C18H13N5O5/c24-18(22-19-9-11-2-1-3-13(6-11)23(25)26)15-8-14(20-21-15)12-4-5-16-17(7-12)28-10-27-16/h1-9H,10H2,(H,20,21)(H,22,24) |
| InChIK | GNTSXXRUBIWCAK-UHFFFAOYSA-N |
| TotalMolweight | 379.331 |
| Molweight | 379.331 |
| MonoisotopicMass | 379.09167 |
| CLogP | 2.0892 |
| CLogS | -5.267 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 279.01 |
| Relative PSA | 0.39923 |
| PolarSurfaceArea | 134.42 |
| Druglikeness | 0.415 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide