| MolName | 1-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-3-pyridin-3-ylthiourea |
| MolecularFormula | C27H24N4O2S |
| Smiles | S=C(Nc1cnccc1)N/N=C\c(cc1)cc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H24N4O2S/c34-27(30-24-12-7-15-28-18-24)31-29-17-23-13-14-25(32-19-21-8-3-1-4-9-21)26(16-23)33-20-22-10-5-2-6-11-22/h1-18H,19-20H2,(H2,30,31,34) |
| InChIK | GNXRCHZVZVSATK-UHFFFAOYSA-N |
| TotalMolweight | 468.58 |
| Molweight | 468.58 |
| MonoisotopicMass | 468.161996 |
| CLogP | 5.2875 |
| CLogS | -6.208 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 379.21 |
| Relative PSA | 0.2463 |
| PolarSurfaceArea | 99.86 |
| Druglikeness | 1.8021 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-3-pyridin-3-ylthiourea | 2 - 1-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-3-pyridin-3-ylthiourea