| MolName | N-[(Z)-benzylideneamino]-2-morpholin-4-ylacetamide |
| MolecularFormula | C13H17N3O2 |
| Smiles | O=C(CN1CCOCC1)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C13H17N3O2/c17-13(11-16-6-8-18-9-7-16)15-14-10-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H,15,17) |
| InChIK | GODLAISLBYYNAD-UHFFFAOYSA-N |
| TotalMolweight | 247.297 |
| Molweight | 247.297 |
| MonoisotopicMass | 247.132077 |
| CLogP | 1.0203 |
| CLogS | -1.741 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 202.83 |
| Relative PSA | 0.24434 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 5.4336 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-morpholin-4-ylacetamide | 2 - N-[(Z)-benzylideneamino]-2-morpholin-4-ylacetamide