| MolName | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-(2-iodophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H12N3O2IS |
| Smiles | O=C(CSc1nc(cccc2)c2o1)N/N=C\c(cccc1)c1I |
| InChI | InChI=1S/C16H12IN3O2S/c17-12-6-2-1-5-11(12)9-18-20-15(21)10-23-16-19-13-7-3-4-8-14(13)22-16/h1-9H,10H2,(H,20,21) |
| InChIK | GORGHMUDOKRCIB-UHFFFAOYSA-N |
| TotalMolweight | 437.256 |
| Molweight | 437.256 |
| MonoisotopicMass | 436.969495 |
| CLogP | 4.1054 |
| CLogS | -5.893 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 267.57 |
| Relative PSA | 0.29368 |
| PolarSurfaceArea | 92.79 |
| Druglikeness | 5.1224 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-(2-iodophenyl)methylideneamino]acetamide | 2 - 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-(2-iodophenyl)methylideneamino]acetamide